cas: 68236-35-1 — see every product listed under this CAS number, including other names
2-Bromo-6-chlorothieno[2,3-b]pyridine, 98% (stabilized with Cu+HQ+MgO), 98% (stabilized with Cu+HQ+MgO) (CAS 68236-35-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FCM5-100mg |
| cas | 68236-35-1 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 500mg | 1269.20 Pln | |
| Chemat | 1g | 1629.20 Pln | |
| Chemat | 5g | 4758.80 Pln |
| purity | 98% (stabilized with Cu+HQ+MgO) |
|---|---|
| delivery time | 3 weeks |
2-bromo-6-chlorothieno[2,3-b]pyridine (CAS 68236-35-1) is a chemical compound with the molecular formula C7H3BrClNS and a molecular weight of 248.53 g/mol. IUPAC name: 2-bromo-6-chlorothieno[2,3-b]pyridine. InChIKey: ZXVWVCBUASMPQD-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNS |
|---|---|
| Molecular weight | 248.53 g/mol |
| IUPAC name | 2-bromo-6-chlorothieno[2,3-b]pyridine |
| InChIKey | ZXVWVCBUASMPQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C=C(S2)Br)Cl |
Computed by PubChem (NCBI)