cas: 455-58-3 — see every product listed under this CAS number, including other names
2-Bromo-6-fluoro-4-nitroaniline 97% (CAS 455-58-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A872022-250mg |
| cas | 455-58-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 414.88 Pln | |
| Ambeed | 10g | 587.31 Pln | |
| Ambeed | 25g | 1104.63 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A872022 |
2-bromo-6-fluoro-4-nitroaniline (CAS 455-58-3) is a chemical compound with the molecular formula C6H4BrFN2O2 and a molecular weight of 235.01 g/mol. IUPAC name: 2-bromo-6-fluoro-4-nitroaniline. InChIKey: YAQFGXYPGJATMT-UHFFFAOYSA-N.
| Molecular formula | C6H4BrFN2O2 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 2-bromo-6-fluoro-4-nitroaniline |
| InChIKey | YAQFGXYPGJATMT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)N)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)