cas: 1321518-06-2 — see every product listed under this CAS number, including other names
2-Bromo-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%+, 95%+ (CAS 1321518-06-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110WTA-100mg |
| cas | 1321518-06-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 693.20 Pln | |
| Chemat | 1g | 1523.60 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
2-bromo-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1321518-06-2) is a chemical compound with the molecular formula C12H17BBrNO2 and a molecular weight of 297.99 g/mol. IUPAC name: 2-bromo-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: VUXGPHWZUJGTFK-UHFFFAOYSA-N.
| Molecular formula | C12H17BBrNO2 |
|---|---|
| Molecular weight | 297.99 g/mol |
| IUPAC name | 2-bromo-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | VUXGPHWZUJGTFK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)Br)C |
Computed by PubChem (NCBI)