CAS 1256360-43-6 appears in our catalog under these names: 5-Bromo-2-methylpyridine-3-boronic acid, pinacol ester, 96%, 5-Bromo-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 1g, 5g.
5-bromo-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1256360-43-6) is a chemical compound with the molecular formula C12H17BBrNO2 and a molecular weight of 297.99 g/mol. IUPAC name: 5-bromo-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: YWJIZPJTDMKKCO-UHFFFAOYSA-N.
| Molecular formula | C12H17BBrNO2 |
|---|---|
| Molecular weight | 297.99 g/mol |
| IUPAC name | 5-bromo-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | YWJIZPJTDMKKCO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2C)Br |
Computed by PubChem (NCBI)