CAS 2043397-75-5 is the registry number for 3-Bromo-4-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
3-bromo-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2043397-75-5) is a chemical compound with the molecular formula C12H17BBrNO2 and a molecular weight of 297.99 g/mol. IUPAC name: 3-bromo-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: QDXKZTBYHOKNFO-UHFFFAOYSA-N.
| Molecular formula | C12H17BBrNO2 |
|---|---|
| Molecular weight | 297.99 g/mol |
| IUPAC name | 3-bromo-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | QDXKZTBYHOKNFO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CC(=C2C)Br |
Computed by PubChem (NCBI)