cas: 1129540-65-3 — see every product listed under this CAS number, including other names
2-Bromo-6-morpholinobenzonitrile 98% (CAS 1129540-65-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A671639-250mg |
| cas | 1129540-65-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 909.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A671639 |
2-bromo-6-morpholin-4-ylbenzonitrile (CAS 1129540-65-3) is a chemical compound with the molecular formula C11H11BrN2O and a molecular weight of 267.12 g/mol. IUPAC name: 2-bromo-6-morpholin-4-ylbenzonitrile. InChIKey: HKIGGSMIIBGCKZ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 2-bromo-6-morpholin-4-ylbenzonitrile |
| InChIKey | HKIGGSMIIBGCKZ-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C(=CC=C2)Br)C#N |
Computed by PubChem (NCBI)