Products 1823346-82-2
CAS 1823346-82-2 appears in our catalog under these names: (1-(4-Bromo-3-methylphenyl)-1h-pyrazol-4-yl)methanol, 95%, (1-(4-Bromo-3-methylphenyl)-1H-pyrazol-4-yl)methanol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg.
[1-(4-bromo-3-methylphenyl)pyrazol-4-yl]methanol (CAS 1823346-82-2) is a chemical compound with the molecular formula C11H11BrN2O and a molecular weight of 267.12 g/mol. IUPAC name: [1-(4-bromo-3-methylphenyl)pyrazol-4-yl]methanol. InChIKey: WASJKOVJWNXBRP-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | [1-(4-bromo-3-methylphenyl)pyrazol-4-yl]methanol |
| InChIKey | WASJKOVJWNXBRP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C=C(C=N2)CO)Br |
Computed by PubChem (NCBI)