Products 312750-72-4

CAS 312750-72-4 is the registry number for 3-(4-Bromophenyl)-5-propyl-1,2,4-oxadiazole, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 500g, 1g, 100g, 5g.

Structural formula: {0} (CAS {1})

3-(4-bromophenyl)-5-propyl-1,2,4-oxadiazole (CAS 312750-72-4) is a chemical compound with the molecular formula C11H11BrN2O and a molecular weight of 267.12 g/mol. IUPAC name: 3-(4-bromophenyl)-5-propyl-1,2,4-oxadiazole. InChIKey: QRBNCGXPBZAMIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11BrN2O
Molecular weight267.12 g/mol
IUPAC name3-(4-bromophenyl)-5-propyl-1,2,4-oxadiazole
InChIKeyQRBNCGXPBZAMIZ-UHFFFAOYSA-N
SMILESCCCC1=NC(=NO1)C2=CC=C(C=C2)Br

Computed by PubChem (NCBI)