cas: 66217-20-7 — see every product listed under this CAS number, including other names
2-Bromo-6-n-butyloxynaphthalene (CAS 66217-20-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F401134-250MG |
| cas | 66217-20-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 513.38 Pln | |
| Fluorochem | 10g | 950.72 Pln | |
| Fluorochem | 25g | 1877.48 Pln |
| delivery time | 3-4 weeks |
|---|
2-bromo-6-butoxynaphthalene (CAS 66217-20-7) is a chemical compound with the molecular formula C14H15BrO and a molecular weight of 279.17 g/mol. IUPAC name: 2-bromo-6-butoxynaphthalene. InChIKey: LIQQRPRDWMYCPK-UHFFFAOYSA-N.
| Molecular formula | C14H15BrO |
|---|---|
| Molecular weight | 279.17 g/mol |
| IUPAC name | 2-bromo-6-butoxynaphthalene |
| InChIKey | LIQQRPRDWMYCPK-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC2=C(C=C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)