cas: 3507-58-2 — see every product listed under this CAS number, including other names
2-Bromo-7-chlorobenzo[d]thiazole, 95%, 95% (CAS 3507-58-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C90T-100mg |
| cas | 3507-58-2 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 842.00 Pln | |
| Chemat | 1g | 1619.60 Pln | |
| Chemat | 5g | 4922.00 Pln | |
| Chemat | 25g | 17075.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-bromo-7-chloro-1,3-benzothiazole (CAS 3507-58-2) is a chemical compound with the molecular formula C7H3BrClNS and a molecular weight of 248.53 g/mol. IUPAC name: 2-bromo-7-chloro-1,3-benzothiazole. InChIKey: RXKINMFVXOEAHJ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNS |
|---|---|
| Molecular weight | 248.53 g/mol |
| IUPAC name | 2-bromo-7-chloro-1,3-benzothiazole |
| InChIKey | RXKINMFVXOEAHJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)SC(=N2)Br |
Computed by PubChem (NCBI)