cas: 951885-74-8 — see every product listed under this CAS number, including other names
2-Bromo-N-cyclopropylisonicotinamide, 97% (CAS 951885-74-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211743-1G |
| cas | 951885-74-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 737.26 Pln | |
| Fluorochem | 5g | 1716.08 Pln | |
| Fluorochem | 25g | 4444.29 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-N-cyclopropylpyridine-4-carboxamide (CAS 951885-74-8) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 2-bromo-N-cyclopropylpyridine-4-carboxamide. InChIKey: AYNACGIRZWTSCN-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 2-bromo-N-cyclopropylpyridine-4-carboxamide |
| InChIKey | AYNACGIRZWTSCN-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=CC(=NC=C2)Br |
Computed by PubChem (NCBI)