cas: 94191-73-8 — see every product listed under this CAS number, including other names
2-Bromobenzyl phenyl ether (CAS 94191-73-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F337041-1G |
| cas | 94191-73-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3069.77 Pln | |
| Fluorochem | 5g | 9072.86 Pln |
| delivery time | 3-4 weeks |
|---|
1-bromo-2-(phenoxymethyl)benzene (CAS 94191-73-8) is a chemical compound with the molecular formula C13H11BrO and a molecular weight of 263.13 g/mol. IUPAC name: 1-bromo-2-(phenoxymethyl)benzene. InChIKey: MUVRARONQUQSLM-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO |
|---|---|
| Molecular weight | 263.13 g/mol |
| IUPAC name | 1-bromo-2-(phenoxymethyl)benzene |
| InChIKey | MUVRARONQUQSLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=CC=CC=C2Br |
Computed by PubChem (NCBI)