CAS 155291-43-3 is the registry number for 4-Benzyl-2-bromophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
4-benzyl-2-bromophenol (CAS 155291-43-3) is a chemical compound with the molecular formula C13H11BrO and a molecular weight of 263.13 g/mol. IUPAC name: 4-benzyl-2-bromophenol. InChIKey: OURWGQUABTTWKO-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO |
|---|---|
| Molecular weight | 263.13 g/mol |
| IUPAC name | 4-benzyl-2-bromophenol |
| InChIKey | OURWGQUABTTWKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=C(C=C2)O)Br |
Computed by PubChem (NCBI)