CAS 1620776-66-0 is the registry number for 2-Bromo-6-cyclopropoxynaphthalene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-bromo-6-cyclopropyloxynaphthalene (CAS 1620776-66-0) is a chemical compound with the molecular formula C13H11BrO and a molecular weight of 263.13 g/mol. IUPAC name: 2-bromo-6-cyclopropyloxynaphthalene. InChIKey: YYMZWJMEJNMKRV-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO |
|---|---|
| Molecular weight | 263.13 g/mol |
| IUPAC name | 2-bromo-6-cyclopropyloxynaphthalene |
| InChIKey | YYMZWJMEJNMKRV-UHFFFAOYSA-N |
| SMILES | C1CC1OC2=CC3=C(C=C2)C=C(C=C3)Br |
Computed by PubChem (NCBI)