2-Bromoisophthalaldehyde, 98%, 98%
cas: 79839-49-9 — see every product listed under this CAS number, including other names
2-Bromoisophthalaldehyde, 98%, 98% (CAS 79839-49-9) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GRI-1kg |
| cas | 79839-49-9 |
| size | 1kg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 6078.80 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 208.40 Pln | |
| Chemat | 25g | 424.40 Pln | |
| Chemat | 50g | 770.00 Pln | |
| Chemat | 100g | 1442.00 Pln | |
| Chemat | 250g | 3165.20 Pln | |
| Chemat | 500g | 5505.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-bromobenzene-1,3-dicarbaldehyde (CAS 79839-49-9) is a chemical compound with the molecular formula C8H5BrO2 and a molecular weight of 213.03 g/mol. IUPAC name: 2-bromobenzene-1,3-dicarbaldehyde. InChIKey: RZUSSKMZLHKMHU-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO2 |
|---|---|
| Molecular weight | 213.03 g/mol |
| IUPAC name | 2-bromobenzene-1,3-dicarbaldehyde |
| InChIKey | RZUSSKMZLHKMHU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C=O)Br)C=O |
Computed by PubChem (NCBI)