CAS 115035-43-3 is the registry number for 3-Bromo-2-coumaranone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-bromo-3H-1-benzofuran-2-one (CAS 115035-43-3) is a chemical compound with the molecular formula C8H5BrO2 and a molecular weight of 213.03 g/mol. IUPAC name: 3-bromo-3H-1-benzofuran-2-one. InChIKey: MXSVEBOOHMKMQG-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO2 |
|---|---|
| Molecular weight | 213.03 g/mol |
| IUPAC name | 3-bromo-3H-1-benzofuran-2-one |
| InChIKey | MXSVEBOOHMKMQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(=O)O2)Br |
Computed by PubChem (NCBI)