CAS 64169-34-2 appears in our catalog under these names: 5-Bromophthalide, 5–Bromophthalide, 5-Bromophthalide, 98% , 5-Bromophthalide, 98%, 5-Bromophthalide, >98.0%(GC). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), TCI. Available pack sizes: 10g, 25g, 5g, 100g, 1g, 500g, 1000g, 5kg.
5-bromo-3H-2-benzofuran-1-one (CAS 64169-34-2) is a chemical compound with the molecular formula C8H5BrO2 and a molecular weight of 213.03 g/mol. IUPAC name: 5-bromo-3H-2-benzofuran-1-one. InChIKey: IUSPXLCLQIZFHL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO2 |
|---|---|
| Molecular weight | 213.03 g/mol |
| IUPAC name | 5-bromo-3H-2-benzofuran-1-one |
| InChIKey | IUSPXLCLQIZFHL-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Br)C(=O)O1 |
Computed by PubChem (NCBI)