cas: 31575-75-4 — see every product listed under this CAS number, including other names
2-Bromophenyl benzyl ether, 97% (CAS 31575-75-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023887-5G |
| cas | 31575-75-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 190.58 Pln | |
| Fluorochem | 100g | 487.35 Pln | |
| Fluorochem | 500g | 2163.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-bromo-2-phenylmethoxybenzene (CAS 31575-75-4) is a chemical compound with the molecular formula C13H11BrO and a molecular weight of 263.13 g/mol. IUPAC name: 1-bromo-2-phenylmethoxybenzene. InChIKey: NBHAHMHUMMWFPJ-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO |
|---|---|
| Molecular weight | 263.13 g/mol |
| IUPAC name | 1-bromo-2-phenylmethoxybenzene |
| InChIKey | NBHAHMHUMMWFPJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC=C2Br |
Computed by PubChem (NCBI)