cas: 91599-78-9 — see every product listed under this CAS number, including other names
2-Butenoic acid, 3-amino-, 1-(phenylmethyl)-3-piperidinyl ester, 95%+, 95%+ (CAS 91599-78-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12IZNG-250mg |
| cas | 91599-78-9 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 1370.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
(1-benzylpiperidin-3-yl) 3-aminobut-2-enoate (CAS 91599-78-9) is a chemical compound with the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. IUPAC name: (1-benzylpiperidin-3-yl) 3-aminobut-2-enoate. InChIKey: FRGGELDLHZANRO-UHFFFAOYSA-N.
| Molecular formula | C16H22N2O2 |
|---|---|
| Molecular weight | 274.36 g/mol |
| IUPAC name | (1-benzylpiperidin-3-yl) 3-aminobut-2-enoate |
| InChIKey | FRGGELDLHZANRO-UHFFFAOYSA-N |
| SMILES | CC(=CC(=O)OC1CCCN(C1)CC2=CC=CC=C2)N |
Computed by PubChem (NCBI)