CAS 387827-18-1 is the registry number for tert-Butyl 4-(3-aminophenyl)-5,6-dihydropyridine-1(2h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 4-(3-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 387827-18-1) is a chemical compound with the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. IUPAC name: tert-butyl 4-(3-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: HPSJZYBXANBFJH-UHFFFAOYSA-N.
| Molecular formula | C16H22N2O2 |
|---|---|
| Molecular weight | 274.36 g/mol |
| IUPAC name | tert-butyl 4-(3-aminophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | HPSJZYBXANBFJH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=CC1)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)