Products 1255574-67-4

CAS 1255574-67-4 is the registry number for tert-Butyl spiro[indoline-2,3'-pyrrolidine]-1'-carboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl spiro[1,3-dihydroindole-2,3'-pyrrolidine]-1'-carboxylate (CAS 1255574-67-4) is a chemical compound with the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. IUPAC name: tert-butyl spiro[1,3-dihydroindole-2,3'-pyrrolidine]-1'-carboxylate. InChIKey: WOICJXSOFFVKPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22N2O2
Molecular weight274.36 g/mol
IUPAC nametert-butyl spiro[1,3-dihydroindole-2,3'-pyrrolidine]-1'-carboxylate
InChIKeyWOICJXSOFFVKPZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(C1)CC3=CC=CC=C3N2

Computed by PubChem (NCBI)