cas: 67362-76-9 — see every product listed under this CAS number, including other names
2-Butoxyethyl 4-(dimethylamino)benzoate (CAS 67362-76-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F329988-1G |
| cas | 67362-76-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 627.92 Pln | |
| Fluorochem | 25g | 1596.33 Pln |
| delivery time | 3-4 weeks |
|---|
2-butoxyethyl 4-(dimethylamino)benzoate (CAS 67362-76-9) is a chemical compound with the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. IUPAC name: 2-butoxyethyl 4-(dimethylamino)benzoate. InChIKey: PAAVDLDRAZEFGW-UHFFFAOYSA-N.
| Molecular formula | C15H23NO3 |
|---|---|
| Molecular weight | 265.35 g/mol |
| IUPAC name | 2-butoxyethyl 4-(dimethylamino)benzoate |
| InChIKey | PAAVDLDRAZEFGW-UHFFFAOYSA-N |
| SMILES | CCCCOCCOC(=O)C1=CC=C(C=C1)N(C)C |
Computed by PubChem (NCBI)