CAS 1189805-10-4 appears in our catalog under these names: Oxprenolol-d7, Oxprenolol–d7, Oxprenolol-d7, 98.05%. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 1 mg.
1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-(2-prop-2-enoxyphenoxy)propan-2-ol (CAS 1189805-10-4) is a chemical compound with the molecular formula C15H23NO3 and a molecular weight of 272.39 g/mol. IUPAC name: 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-(2-prop-2-enoxyphenoxy)propan-2-ol. InChIKey: CEMAWMOMDPGJMB-JLTHDCAWSA-N.
| Molecular formula | C15H23NO3 |
|---|---|
| Molecular weight | 272.39 g/mol |
| IUPAC name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-(2-prop-2-enoxyphenoxy)propan-2-ol |
| InChIKey | CEMAWMOMDPGJMB-JLTHDCAWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=CC=C1OCC=C)O |
Computed by PubChem (NCBI)