Products 126192-86-7
CAS 126192-86-7 appears in our catalog under these names: tert-butyl n-(1-hydroxy-1-phenylpropan-2-yl)-n-methylcarbamate, 95%, tert-Butyl N-(1-hydroxy-1-phenylpropan-2-yl)-N-methylcarbamate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Tert-butyl N-(1-hydroxy-1-phenylpropan-2-yl)-N-methylcarbamate (CAS 126192-86-7) is a chemical compound with the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. IUPAC name: tert-butyl N-(1-hydroxy-1-phenylpropan-2-yl)-N-methylcarbamate. InChIKey: SIKODEFLCMOILM-UHFFFAOYSA-N.
| Molecular formula | C15H23NO3 |
|---|---|
| Molecular weight | 265.35 g/mol |
| IUPAC name | tert-butyl N-(1-hydroxy-1-phenylpropan-2-yl)-N-methylcarbamate |
| InChIKey | SIKODEFLCMOILM-UHFFFAOYSA-N |
| SMILES | CC(C(C1=CC=CC=C1)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)