cas: 2653-16-9 — see every product listed under this CAS number, including other names
2-CHLORO-N-METHYL-N-(4-NITROPHENYL)ACETAMIDE, 98%, 98% (CAS 2653-16-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113TKO-100mg |
| cas | 2653-16-9 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 630.80 Pln | |
| Chemat | 10g | 938.00 Pln | |
| Chemat | 25g | 1811.60 Pln | |
| Chemat | 100g | 5306.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-N-methyl-N-(4-nitrophenyl)acetamide (CAS 2653-16-9) is a chemical compound with the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. IUPAC name: 2-chloro-N-methyl-N-(4-nitrophenyl)acetamide. InChIKey: JAWLWNKATJAODJ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O3 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 2-chloro-N-methyl-N-(4-nitrophenyl)acetamide |
| InChIKey | JAWLWNKATJAODJ-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)[N+](=O)[O-])C(=O)CCl |
Computed by PubChem (NCBI)