CAS 2790-97-8 is the registry number for 3-Chloro-n-(2-nitrophenyl)propanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-chloro-N-(2-nitrophenyl)propanamide (CAS 2790-97-8) is a chemical compound with the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. IUPAC name: 3-chloro-N-(2-nitrophenyl)propanamide. InChIKey: DULRZGMBDVZDSR-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O3 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 3-chloro-N-(2-nitrophenyl)propanamide |
| InChIKey | DULRZGMBDVZDSR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)CCCl)[N+](=O)[O-] |
Computed by PubChem (NCBI)