CAS 1820648-39-2 is the registry number for methyl 5-chloro-2-acetamidopyridine-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2-acetamido-5-chloropyridine-4-carboxylate (CAS 1820648-39-2) is a chemical compound with the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. IUPAC name: methyl 2-acetamido-5-chloropyridine-4-carboxylate. InChIKey: PDLVJVNFDFVDPG-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O3 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | methyl 2-acetamido-5-chloropyridine-4-carboxylate |
| InChIKey | PDLVJVNFDFVDPG-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC=C(C(=C1)C(=O)OC)Cl |
Computed by PubChem (NCBI)