2-Carboxy-3-methylpyridine 1-oxide, 97%
cas: 83199-81-9 — see every product listed under this CAS number, including other names
2-Carboxy-3-methylpyridine 1-oxide, 97% (CAS 83199-81-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1005663-100mg |
| cas | 83199-81-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 403.75 Pln | |
| BLDpharm | 100mg | 147.75 Pln | |
| BLDpharm | 250mg | 203.29 Pln | |
| BLDpharm | 1g | 430.98 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 333.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
3-methyl-1-oxidopyridin-1-ium-2-carboxylic acid (CAS 83199-81-9) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 3-methyl-1-oxidopyridin-1-ium-2-carboxylic acid. InChIKey: GWTAIBYPPWDZJW-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 3-methyl-1-oxidopyridin-1-ium-2-carboxylic acid |
| InChIKey | GWTAIBYPPWDZJW-UHFFFAOYSA-N |
| SMILES | CC1=C([N+](=CC=C1)[O-])C(=O)O |
Computed by PubChem (NCBI)