Products 83199-81-9
CAS 83199-81-9 appears in our catalog under these names: 2-Carboxy-3-methylpyridine 1-oxide 97%, 2-Carboxy-3-methylpyridine 1-oxide, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-methyl-1-oxidopyridin-1-ium-2-carboxylic acid (CAS 83199-81-9) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 3-methyl-1-oxidopyridin-1-ium-2-carboxylic acid. InChIKey: GWTAIBYPPWDZJW-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 3-methyl-1-oxidopyridin-1-ium-2-carboxylic acid |
| InChIKey | GWTAIBYPPWDZJW-UHFFFAOYSA-N |
| SMILES | CC1=C([N+](=CC=C1)[O-])C(=O)O |
Computed by PubChem (NCBI)