Products 33821-58-8

CAS 33821-58-8 is the registry number for 6-Methyl-4-oxo-1,4-dihydropyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

6-methyl-4-oxo-1H-pyridine-3-carboxylic acid (CAS 33821-58-8) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 6-methyl-4-oxo-1H-pyridine-3-carboxylic acid. InChIKey: AOJLDZLRTUWFFY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7NO3
Molecular weight153.14 g/mol
IUPAC name6-methyl-4-oxo-1H-pyridine-3-carboxylic acid
InChIKeyAOJLDZLRTUWFFY-UHFFFAOYSA-N
SMILESCC1=CC(=O)C(=CN1)C(=O)O

Computed by PubChem (NCBI)