cas: 4209-25-0 — see every product listed under this CAS number, including other names
2-Chloro-1-(2-chlorophenyl)ethanone, 97%, 97% (CAS 4209-25-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120ZSE-100mg |
| cas | 4209-25-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 525.20 Pln | |
| Chemat | 5g | 3899.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-1-(2-chlorophenyl)ethanone (CAS 4209-25-0) is a chemical compound with the molecular formula C8H6Cl2O and a molecular weight of 189.04 g/mol. IUPAC name: 2-chloro-1-(2-chlorophenyl)ethanone. InChIKey: SOGLGKRIVMZMSK-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | 2-chloro-1-(2-chlorophenyl)ethanone |
| InChIKey | SOGLGKRIVMZMSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CCl)Cl |
Computed by PubChem (NCBI)