CAS 21900-56-1 is the registry number for 2-Chloro-3-methylbenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-chloro-3-methylbenzoyl chloride (CAS 21900-56-1) is a chemical compound with the molecular formula C8H6Cl2O and a molecular weight of 189.04 g/mol. IUPAC name: 2-chloro-3-methylbenzoyl chloride. InChIKey: FUUCTBPASNZPKE-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | 2-chloro-3-methylbenzoyl chloride |
| InChIKey | FUUCTBPASNZPKE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)Cl)Cl |
Computed by PubChem (NCBI)