Products 21900-40-3

CAS 21900-40-3 is the registry number for 5-Chloro-2-methylbenzoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

5-chloro-2-methylbenzoyl chloride (CAS 21900-40-3) is a chemical compound with the molecular formula C8H6Cl2O and a molecular weight of 189.04 g/mol. IUPAC name: 5-chloro-2-methylbenzoyl chloride. InChIKey: WKSLUZTZBSDWDE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Cl2O
Molecular weight189.04 g/mol
IUPAC name5-chloro-2-methylbenzoyl chloride
InChIKeyWKSLUZTZBSDWDE-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)Cl)C(=O)Cl

Computed by PubChem (NCBI)