CAS 21900-40-3 is the registry number for 5-Chloro-2-methylbenzoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
5-chloro-2-methylbenzoyl chloride (CAS 21900-40-3) is a chemical compound with the molecular formula C8H6Cl2O and a molecular weight of 189.04 g/mol. IUPAC name: 5-chloro-2-methylbenzoyl chloride. InChIKey: WKSLUZTZBSDWDE-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | 5-chloro-2-methylbenzoyl chloride |
| InChIKey | WKSLUZTZBSDWDE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)C(=O)Cl |
Computed by PubChem (NCBI)