cas: 189024-26-8 — see every product listed under this CAS number, including other names
2-Chloro-3,5-difluorobenzoic acid, 98%, 98% (CAS 189024-26-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AT6F-100mg |
| cas | 189024-26-8 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 500mg | 578.00 Pln | |
| Chemat | 1g | 784.40 Pln | |
| Chemat | 5g | 2651.60 Pln | |
| Chemat | 10g | 4662.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-3,5-difluorobenzoic acid (CAS 189024-26-8) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 2-chloro-3,5-difluorobenzoic acid. InChIKey: MDKCKPVYRHHFAL-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 2-chloro-3,5-difluorobenzoic acid |
| InChIKey | MDKCKPVYRHHFAL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Cl)F)F |
Computed by PubChem (NCBI)