CAS 189024-26-8 appears in our catalog under these names: 2-Chloro-3,5-difluorobenzoic acid, 95%, 2-Chloro-3,5-difluorobenzoic acid, 98%, 2-Chloro-3,5-difluorobenzoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg, 10g, 25g.
2-chloro-3,5-difluorobenzoic acid (CAS 189024-26-8) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 2-chloro-3,5-difluorobenzoic acid. InChIKey: MDKCKPVYRHHFAL-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 2-chloro-3,5-difluorobenzoic acid |
| InChIKey | MDKCKPVYRHHFAL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Cl)F)F |
Computed by PubChem (NCBI)