CAS 1197181-09-1 is the registry number for 1,3-Benzodioxole, 4-chloro-2,2-difluoro-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-chloro-2,2-difluoro-1,3-benzodioxole (CAS 1197181-09-1) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 4-chloro-2,2-difluoro-1,3-benzodioxole. InChIKey: HYRYIXPXXZPGTJ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 4-chloro-2,2-difluoro-1,3-benzodioxole |
| InChIKey | HYRYIXPXXZPGTJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)OC(O2)(F)F |
Computed by PubChem (NCBI)