cas: 132118-28-6 — see every product listed under this CAS number, including other names
2-Chloro-3,6-dimethylquinoline, ≥97%, ≥97% (CAS 132118-28-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112101-100mg |
| cas | 132118-28-6 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 568.40 Pln | |
| Chemat | 1g | 1470.80 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-3,6-dimethylquinoline (CAS 132118-28-6) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 2-chloro-3,6-dimethylquinoline. InChIKey: OVBZFZKRCZPILH-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 2-chloro-3,6-dimethylquinoline |
| InChIKey | OVBZFZKRCZPILH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C(=C2)C)Cl |
Computed by PubChem (NCBI)