CAS 861038-79-1 appears in our catalog under these names: 4-Chloro-6,7-dimethylquinoline, 95%, 4-Chloro-6,7-dimethylquinoline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-chloro-6,7-dimethylquinoline (CAS 861038-79-1) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 4-chloro-6,7-dimethylquinoline. InChIKey: CAQMLALPIYZLFE-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 4-chloro-6,7-dimethylquinoline |
| InChIKey | CAQMLALPIYZLFE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CN=C2C=C1C)Cl |
Computed by PubChem (NCBI)