CAS 3913-18-6 appears in our catalog under these names: 2-Chloro-4,6-dimethylquinoline, 95%, 2-Chloro-4,6-dimethylquinoline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
2-chloro-4,6-dimethylquinoline (CAS 3913-18-6) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 2-chloro-4,6-dimethylquinoline. InChIKey: UPMJOZIDQGBLDI-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 2-chloro-4,6-dimethylquinoline |
| InChIKey | UPMJOZIDQGBLDI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C=C2C)Cl |
Computed by PubChem (NCBI)