cas: 1400755-07-8 — see every product listed under this CAS number, including other names
2-Chloro-3-(hydroxymethyl)phenylboronic Acid Pinacol Ester, 95%, 95% (CAS 1400755-07-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112C11-100mg |
| cas | 1400755-07-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 885.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol (CAS 1400755-07-8) is a chemical compound with the molecular formula C13H18BClO3 and a molecular weight of 268.54 g/mol. IUPAC name: [2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol. InChIKey: HBLMMENVLOTBES-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO3 |
|---|---|
| Molecular weight | 268.54 g/mol |
| IUPAC name | [2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
| InChIKey | HBLMMENVLOTBES-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)CO)Cl |
Computed by PubChem (NCBI)