cas: 182052-67-1 — see every product listed under this CAS number, including other names
2-Chloro-3-chloromethyl-6,7-dimethylquinoline, 97%, 97% (CAS 182052-67-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1134BC-100mg |
| cas | 182052-67-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 1g | 1144.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-3-(chloromethyl)-6,7-dimethylquinoline (CAS 182052-67-1) is a chemical compound with the molecular formula C12H11Cl2N and a molecular weight of 240.12 g/mol. IUPAC name: 2-chloro-3-(chloromethyl)-6,7-dimethylquinoline. InChIKey: CCUOWAKNYKHISD-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 2-chloro-3-(chloromethyl)-6,7-dimethylquinoline |
| InChIKey | CCUOWAKNYKHISD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=C(N=C2C=C1C)Cl)CCl |
Computed by PubChem (NCBI)