CAS 948290-59-3 is the registry number for 2-Chloro-3-chloromethyl-5,7-dimethylquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-3-(chloromethyl)-5,7-dimethylquinoline (CAS 948290-59-3) is a chemical compound with the molecular formula C12H11Cl2N and a molecular weight of 240.12 g/mol. IUPAC name: 2-chloro-3-(chloromethyl)-5,7-dimethylquinoline. InChIKey: MUOUPNFBZGRTAD-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 2-chloro-3-(chloromethyl)-5,7-dimethylquinoline |
| InChIKey | MUOUPNFBZGRTAD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C(=NC2=C1)Cl)CCl)C |
Computed by PubChem (NCBI)