CAS 182052-67-1 appears in our catalog under these names: 2-Chloro-3-chloromethyl-6,7-dimethylquinoline, 95%, 2-Chloro-3-chloromethyl-6,7-dimethylquinoline, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-chloro-3-(chloromethyl)-6,7-dimethylquinoline (CAS 182052-67-1) is a chemical compound with the molecular formula C12H11Cl2N and a molecular weight of 240.12 g/mol. IUPAC name: 2-chloro-3-(chloromethyl)-6,7-dimethylquinoline. InChIKey: CCUOWAKNYKHISD-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 2-chloro-3-(chloromethyl)-6,7-dimethylquinoline |
| InChIKey | CCUOWAKNYKHISD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=C(N=C2C=C1C)Cl)CCl |
Computed by PubChem (NCBI)