2-Chloro-3-fluorobenzoic acid, 96%
cas: 102940-86-3 — see every product listed under this CAS number, including other names
2-Chloro-3-fluorobenzoic acid, 96% (CAS 102940-86-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F005185-1G |
| cas | 102940-86-3 |
| size | 1g |
| availability | In Stock UK |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 247.85 Pln | |
| Fluorochem | 100g | 825.77 Pln | |
| Fluorochem | 500g | 3824.71 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 198.80 Pln | |
| Chemat | 100g | 606.80 Pln |
properties
| purity | 96% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
2-chloro-3-fluorobenzoic acid (CAS 102940-86-3) is a chemical compound with the molecular formula C7H4ClFO2 and a molecular weight of 174.55 g/mol. IUPAC name: 2-chloro-3-fluorobenzoic acid. InChIKey: WJYAYXKXZNITAZ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFO2 |
|---|---|
| Molecular weight | 174.55 g/mol |
| IUPAC name | 2-chloro-3-fluorobenzoic acid |
| InChIKey | WJYAYXKXZNITAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Cl)C(=O)O |
Computed by PubChem (NCBI)