Products 102940-86-3
CAS 102940-86-3 appears in our catalog under these names: 2–Chloro–3–fluorobenzoic acid, 2-Chloro-3-fluorobenzoic acid, 2-Chloro-3-fluorobenzoic acid 97%, 2-Chloro-3-fluorobenzoic acid, 96%, 2-Chloro-3-fluorobenzoic acid, 97%, 97%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 500g.
2-chloro-3-fluorobenzoic acid (CAS 102940-86-3) is a chemical compound with the molecular formula C7H4ClFO2 and a molecular weight of 174.55 g/mol. IUPAC name: 2-chloro-3-fluorobenzoic acid. InChIKey: WJYAYXKXZNITAZ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFO2 |
|---|---|
| Molecular weight | 174.55 g/mol |
| IUPAC name | 2-chloro-3-fluorobenzoic acid |
| InChIKey | WJYAYXKXZNITAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Cl)C(=O)O |
Computed by PubChem (NCBI)