2-Chloro-3-nitropyridin-4-ol, 96%
cas: 629655-23-8 — see every product listed under this CAS number, including other names
2-Chloro-3-nitropyridin-4-ol, 96% (CAS 629655-23-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11ED4T-100mg |
| cas | 629655-23-8 |
| size | 100mg |
| availability | 75g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 962.00 Pln | |
| Chemat | 10g | 1864.40 Pln | |
| Chemat | 25g | 3822.80 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 5g | 1216.26 Pln | |
| Fluorochem | 10g | 2356.48 Pln | |
| Fluorochem | 25g | 4616.10 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-chloro-3-nitro-1H-pyridin-4-one (CAS 629655-23-8) is a chemical compound with the molecular formula C5H3ClN2O3 and a molecular weight of 174.54 g/mol. IUPAC name: 2-chloro-3-nitro-1H-pyridin-4-one. InChIKey: RGJVVCCIZKLJRL-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O3 |
|---|---|
| Molecular weight | 174.54 g/mol |
| IUPAC name | 2-chloro-3-nitro-1H-pyridin-4-one |
| InChIKey | RGJVVCCIZKLJRL-UHFFFAOYSA-N |
| SMILES | C1=CNC(=C(C1=O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)