cas: 80689-35-6 — see every product listed under this CAS number, including other names
2-Chloro-4,6-dimethylbenzo[d]thiazole, 98% (CAS 80689-35-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228882-250MG |
| cas | 80689-35-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 500mg | 690.40 Pln | |
| Fluorochem | 1g | 846.59 Pln | |
| Fluorochem | 2.5g | 2033.68 Pln | |
| Fluorochem | 5g | 2424.16 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-4,6-dimethyl-1,3-benzothiazole (CAS 80689-35-6) is a chemical compound with the molecular formula C9H8ClNS and a molecular weight of 197.69 g/mol. IUPAC name: 2-chloro-4,6-dimethyl-1,3-benzothiazole. InChIKey: DGUINEVXAOBICO-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNS |
|---|---|
| Molecular weight | 197.69 g/mol |
| IUPAC name | 2-chloro-4,6-dimethyl-1,3-benzothiazole |
| InChIKey | DGUINEVXAOBICO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)SC(=N2)Cl)C |
Computed by PubChem (NCBI)