CAS 34006-16-1 appears in our catalog under these names: 8-Mercaptoquinoline hydrochloride, 95%, 8-Quinolinoethiol HCl, 8-Mercaptoquinoline Hydrochloride [Extraction-spectrophotometric and fluorimetric reagent for soft metals], >95.0%(T), 8-Mercaptoquinoline Hydrochloride 95%, 8-Mercaptoquinoline Hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 25g, 100mg.
Quinoline-8-thiol;hydrochloride (CAS 34006-16-1) is a chemical compound with the molecular formula C9H8ClNS and a molecular weight of 197.69 g/mol. IUPAC name: quinoline-8-thiol;hydrochloride. InChIKey: RWBSBQAUAJSGHY-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNS |
|---|---|
| Molecular weight | 197.69 g/mol |
| IUPAC name | quinoline-8-thiol;hydrochloride |
| InChIKey | RWBSBQAUAJSGHY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S)N=CC=C2.Cl |
Computed by PubChem (NCBI)