CAS 871909-88-5 appears in our catalog under these names: 1-Chloro-2-isothiocyanato-3,5-dimethylbenzene, 95%, 1-Chloro-2-isothiocyanato-3,5-dimethylbenzene. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1-chloro-2-isothiocyanato-3,5-dimethylbenzene (CAS 871909-88-5) is a chemical compound with the molecular formula C9H8ClNS and a molecular weight of 197.69 g/mol. IUPAC name: 1-chloro-2-isothiocyanato-3,5-dimethylbenzene. InChIKey: BZMBGNFFOMXBCL-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNS |
|---|---|
| Molecular weight | 197.69 g/mol |
| IUPAC name | 1-chloro-2-isothiocyanato-3,5-dimethylbenzene |
| InChIKey | BZMBGNFFOMXBCL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Cl)N=C=S)C |
Computed by PubChem (NCBI)