cas: 1218790-05-6 — see every product listed under this CAS number, including other names
2-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine, 98%, 98% (CAS 1218790-05-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112792-100mg |
| cas | 1218790-05-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 318.80 Pln | |
| Chemat | 5g | 909.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine (CAS 1218790-05-6) is a chemical compound with the molecular formula C12H14BClF3NO2 and a molecular weight of 307.50 g/mol. IUPAC name: 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine. InChIKey: AQRLOVKDJVLZSA-UHFFFAOYSA-N.
| Molecular formula | C12H14BClF3NO2 |
|---|---|
| Molecular weight | 307.50 g/mol |
| IUPAC name | 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine |
| InChIKey | AQRLOVKDJVLZSA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)